C24H42O4Si — CID 11732598
(3S,4S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3,7-dimethyloctan-2-one (PubChem CID 11732598) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (3S,4S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3,7-dimethyloctan-2-one.
| Compound Name | (3S,4S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3,7-dimethyloctan-2-one |
|---|---|
| PubChem CID | 11732598 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (3S,4S,7R)-8-[tert-butyl(dimethyl)silyl]oxy-4-[(4-methoxyphenyl)methoxy]-3,7-dimethyloctan-2-one |
| SMILES | COc1ccc(CO[C@@H](CC[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@H](C)C(C)=O)cc1 |
| InChI | InChI=1S/C24H42O4Si/c1-18(16-28-29(8,9)24(4,5)6)10-15-23(19(2)20(3)25)27-17-21-11-13-22(26-7)14-12-21/h11-14,18-19,23H,10,15-17H2,1-9H3/t18-,19-,23+/m1/s1 |
| InChIKey | ZOKOKMDFCMAOQV-PWHSHALESA-N |
| XLogP | 6.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|