C25H32O4Si — CID 11732638
(2R,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one (PubChem CID 11732638) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (2R,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 11732638 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2R,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H]2CCCO[C@@H]2CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32O4Si/c1-25(2,3)30(19-11-6-4-7-12-19,20-13-8-5-9-14-20)28-18-24-21(26)17-23-22(29-24)15-10-16-27-23/h4-9,11-14,22-24H,10,15-18H2,1-3H3/t22-,23+,24+/m0/s1 |
| InChIKey | XJZCCVYVXYEXPC-RBZQAINGSA-N |
| XLogP | 3.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|