About [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate
[2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate (PubChem CID 11732676) has the molecular formula C24H30O3SSi
and a molecular weight of 426.65 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate.
Molecular Properties
| Compound Name | [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate |
| PubChem CID | 11732676 |
| Molecular Formula | C24H30O3SSi |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate |
| SMILES | C=C=C(C(OC(C)=O)c1ccccc1)C(SCc1ccc(OC)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H30O3SSi/c1-7-22(23(27-18(2)25)20-11-9-8-10-12-20)24(29(4,5)6)28-17-19-13-15-21(26-3)16-14-19/h8-16,23-24H,1,17H2,2-6H3 |
| InChIKey | YFHSXLXAWBDTEB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate?
The IUPAC name of [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate (CID 11732676) is [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate.
What is the SMILES notation for [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate?
The canonical SMILES for [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate is C=C=C(C(OC(C)=O)c1ccccc1)C(SCc1ccc(OC)cc1)[Si](C)(C)C.
What is the InChIKey of [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate?
The InChIKey is YFHSXLXAWBDTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O3SSi/c1-7-22(23(27-18(2)25)20-11-9-8-10-12-20)24(29(4,5)6)28-17-19-13-15-21(26-3)16-14-19/h8-16,23-24H,1,17H2,2-6H3.
What are the key properties of [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate?
[2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate has a molecular weight of 426.65 g/mol, XLogP of 6.19, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-methoxyphenyl)methylsulfanyl-trimethylsilylmethyl]-1-phenylbuta-2,3-dienyl] acetate is sourced from PubChem (CID 11732676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).