C15H17NO — CID 117327361
7-(1-isocyanatocyclopropyl)-1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 117327361) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 7-(1-isocyanatocyclopropyl)-1-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-(1-isocyanatocyclopropyl)-1-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 117327361 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 7-(1-isocyanatocyclopropyl)-1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CCCc2ccc(C3(N=C=O)CC3)cc21 |
| InChI | InChI=1S/C15H17NO/c1-11-3-2-4-12-5-6-13(9-14(11)12)15(7-8-15)16-10-17/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | DQSUJYTVLOMHAV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|