About 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one
6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one (PubChem CID 11732752) has the molecular formula C21H19BrO5
and a molecular weight of 431.28 g/mol. Its IUPAC name is 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one |
| PubChem CID | 11732752 |
| Molecular Formula | C21H19BrO5 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one |
| SMILES | CC1(C)COC(c2cc(=O)oc3cc(O)c(Br)cc23)OC1c1ccccc1 |
| InChI | InChI=1S/C21H19BrO5/c1-21(2)11-25-20(27-19(21)12-6-4-3-5-7-12)14-9-18(24)26-17-10-16(23)15(22)8-13(14)17/h3-10,19-20,23H,11H2,1-2H3 |
| InChIKey | OYFFZAKHUPKZQI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one?
The IUPAC name of 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one (CID 11732752) is 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one.
What is the SMILES notation for 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one?
The canonical SMILES for 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one is CC1(C)COC(c2cc(=O)oc3cc(O)c(Br)cc23)OC1c1ccccc1.
What is the InChIKey of 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one?
The InChIKey is OYFFZAKHUPKZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19BrO5/c1-21(2)11-25-20(27-19(21)12-6-4-3-5-7-12)14-9-18(24)26-17-10-16(23)15(22)8-13(14)17/h3-10,19-20,23H,11H2,1-2H3.
What are the key properties of 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one?
6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one has a molecular weight of 431.28 g/mol, XLogP of 5.07, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(5,5-dimethyl-4-phenyl-1,3-dioxan-2-yl)-7-hydroxychromen-2-one is sourced from PubChem (CID 11732752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).