C11H14ClNO2 — CID 117327759
1-(3-chloro-2,6-dimethoxyphenyl)cyclopropan-1-amine (PubChem CID 117327759) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 1-(3-chloro-2,6-dimethoxyphenyl)cyclopropan-1-amine.
| Compound Name | 1-(3-chloro-2,6-dimethoxyphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 117327759 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 1-(3-chloro-2,6-dimethoxyphenyl)cyclopropan-1-amine |
| SMILES | COc1ccc(Cl)c(OC)c1C1(N)CC1 |
| InChI | InChI=1S/C11H14ClNO2/c1-14-8-4-3-7(12)10(15-2)9(8)11(13)5-6-11/h3-4H,5-6,13H2,1-2H3 |
| InChIKey | HEGAGQSOKVZDBR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |