C26H44O3Si — CID 11732790
(1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,7b-trimethylspiro[1,1b,2,3,4,6,7,7a,8,9-decahydrocyclopropa[a]phenanthrene-5,2'-oxirane]-4-carbaldehyde (PubChem CID 11732790) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,7b-trimethylspiro[1,1b,2,3,4,6,7,7a,8,9-decahydrocyclopropa[a]phenanthrene-5,2'-oxirane]-4-carbaldehyde.
| Compound Name | (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,7b-trimethylspiro[1,1b,2,3,4,6,7,7a,8,9-decahydrocyclopropa[a]phenanthrene-5,2'-oxirane]-4-carbaldehyde |
|---|---|
| PubChem CID | 11732790 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (1aS,1bR,3aR,7aR,7bR,9aR)-9a-[tert-butyl(dimethyl)silyl]oxy-1a,3a,7b-trimethylspiro[1,1b,2,3,4,6,7,7a,8,9-decahydrocyclopropa[a]phenanthrene-5,2'-oxirane]-4-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]12CC[C@]3(C)[C@H]4CCC5(CO5)C(C=O)[C@]4(C)CC[C@H]3[C@]1(C)C2 |
| InChI | InChI=1S/C26H44O3Si/c1-21(2,3)30(7,8)29-26-14-13-23(5)18-10-12-25(17-28-25)20(15-27)22(18,4)11-9-19(23)24(26,6)16-26/h15,18-20H,9-14,16-17H2,1-8H3/t18-,19+,20?,22+,23+,24-,25?,26+/m0/s1 |
| InChIKey | JYRIFWDVPSOLLF-ZTBUMQMQSA-N |
| XLogP | 6.37 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|