About 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one
6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one (PubChem CID 117328322) has the molecular formula C11H8N4O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one |
| PubChem CID | 117328322 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one |
| SMILES | Nc1oncc1-c1ccc2[nH]c(=O)cnc2c1 |
| InChI | InChI=1S/C11H8N4O2/c12-11-7(4-14-17-11)6-1-2-8-9(3-6)13-5-10(16)15-8/h1-5H,12H2,(H,15,16) |
| InChIKey | IDWFQRYSZUSLBP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one?
The IUPAC name of 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one (CID 117328322) is 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one.
What is the SMILES notation for 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one?
The canonical SMILES for 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one is Nc1oncc1-c1ccc2[nH]c(=O)cnc2c1.
What is the InChIKey of 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one?
The InChIKey is IDWFQRYSZUSLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2/c12-11-7(4-14-17-11)6-1-2-8-9(3-6)13-5-10(16)15-8/h1-5H,12H2,(H,15,16).
What are the key properties of 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one?
6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one has a molecular weight of 228.21 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-amino-1,2-oxazol-4-yl)-1H-quinoxalin-2-one is sourced from PubChem (CID 117328322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).