About 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine
5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine (PubChem CID 117328747) has the molecular formula C12H12N4O
and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine |
| PubChem CID | 117328747 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cccc(N3C=NCC3)c2)on1 |
| InChI | InChI=1S/C12H12N4O/c13-12-7-11(17-15-12)9-2-1-3-10(6-9)16-5-4-14-8-16/h1-3,6-8H,4-5H2,(H2,13,15) |
| InChIKey | NFCRSKPCHGRSJQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine?
The IUPAC name of 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine (CID 117328747) is 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine.
What is the SMILES notation for 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine?
The canonical SMILES for 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine is Nc1cc(-c2cccc(N3C=NCC3)c2)on1.
What is the InChIKey of 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine?
The InChIKey is NFCRSKPCHGRSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c13-12-7-11(17-15-12)9-2-1-3-10(6-9)16-5-4-14-8-16/h1-3,6-8H,4-5H2,(H2,13,15).
What are the key properties of 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine?
5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine has a molecular weight of 228.26 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4,5-dihydroimidazol-1-yl)phenyl]-1,2-oxazol-3-amine is sourced from PubChem (CID 117328747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).