C22H30O7S — CID 11732879
2-[(1S,2R,4R,5S,6S)-2-hydroxy-5-(methoxymethoxymethyl)-6-methyl-3-methylidene-7-oxo-2-bicyclo[2.2.2]octanyl]ethyl 4-methylbenzenesulfonate (PubChem CID 11732879) has the molecular formula C22H30O7S and a molecular weight of 438.54 g/mol. Its IUPAC name is 2-[(1S,2R,4R,5S,6S)-2-hydroxy-5-(methoxymethoxymethyl)-6-methyl-3-methylidene-7-oxo-2-bicyclo[2.2.2]octanyl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1S,2R,4R,5S,6S)-2-hydroxy-5-(methoxymethoxymethyl)-6-methyl-3-methylidene-7-oxo-2-bicyclo[2.2.2]octanyl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11732879 |
| Molecular Formula | C22H30O7S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[(1S,2R,4R,5S,6S)-2-hydroxy-5-(methoxymethoxymethyl)-6-methyl-3-methylidene-7-oxo-2-bicyclo[2.2.2]octanyl]ethyl 4-methylbenzenesulfonate |
| SMILES | C=C1[C@@H]2CC(=O)[C@@H]([C@@H](C)[C@@H]2COCOC)[C@]1(O)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30O7S/c1-14-5-7-17(8-6-14)30(25,26)29-10-9-22(24)16(3)18-11-20(23)21(22)15(2)19(18)12-28-13-27-4/h5-8,15,18-19,21,24H,3,9-13H2,1-2,4H3/t15-,18-,19-,21+,22-/m0/s1 |
| InChIKey | OAPCCLCMZKSJLQ-GKYSZPLNSA-N |
| XLogP | 2.47 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|