C10H9ClO4 — CID 117329355
2-(5-chloro-1,3-benzodioxol-4-yl)propanoic acid (PubChem CID 117329355) has the molecular formula C10H9ClO4 and a molecular weight of 228.63 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzodioxol-4-yl)propanoic acid.
| Compound Name | 2-(5-chloro-1,3-benzodioxol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 117329355 |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-(5-chloro-1,3-benzodioxol-4-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1c(Cl)ccc2c1OCO2 |
| InChI | InChI=1S/C10H9ClO4/c1-5(10(12)13)8-6(11)2-3-7-9(8)15-4-14-7/h2-3,5H,4H2,1H3,(H,12,13) |
| InChIKey | PLCFVENTCBYZJS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.63 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |