About 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol
8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol (PubChem CID 117329813) has the molecular formula C12H7NO4
and a molecular weight of 229.19 g/mol. Its IUPAC name is 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol.
Molecular Properties
| Compound Name | 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol |
| PubChem CID | 117329813 |
| Molecular Formula | C12H7NO4 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol |
| SMILES | O=C=NCc1c2ccoc2c(O)c2ccoc12 |
| InChI | InChI=1S/C12H7NO4/c14-6-13-5-9-7-1-3-17-12(7)10(15)8-2-4-16-11(8)9/h1-4,15H,5H2 |
| InChIKey | SYDMFDUDVKBZCD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol?
The IUPAC name of 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol (CID 117329813) is 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol.
What is the SMILES notation for 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol?
The canonical SMILES for 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol is O=C=NCc1c2ccoc2c(O)c2ccoc12.
What is the InChIKey of 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol?
The InChIKey is SYDMFDUDVKBZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO4/c14-6-13-5-9-7-1-3-17-12(7)10(15)8-2-4-16-11(8)9/h1-4,15H,5H2.
What are the key properties of 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol?
8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol has a molecular weight of 229.19 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(isocyanatomethyl)furo[2,3-f][1]benzofuran-4-ol is sourced from PubChem (CID 117329813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).