C12H11N3O2 — CID 117330160
5-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,2-oxazol-3-amine (PubChem CID 117330160) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 5-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117330160 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cccc(C3=NCCO3)c2)on1 |
| InChI | InChI=1S/C12H11N3O2/c13-11-7-10(17-15-11)8-2-1-3-9(6-8)12-14-4-5-16-12/h1-3,6-7H,4-5H2,(H2,13,15) |
| InChIKey | OEQZIVHVGGUXBW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |