C24H32O6S — CID 11733052
methyl 2-[[(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]benzoate (PubChem CID 11733052) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is methyl 2-[[(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]benzoate.
| Compound Name | methyl 2-[[(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]benzoate |
|---|---|
| PubChem CID | 11733052 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | methyl 2-[[(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-5-oxo-6-oxabicyclo[11.3.0]hexadec-11-en-3-yl]sulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1S[C@@H]1CC(=O)O[C@@H](C)CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@@H]1O |
| InChI | InChI=1S/C24H32O6S/c1-15-8-4-3-5-9-16-12-17(25)13-19(16)23(27)21(14-22(26)30-15)31-20-11-7-6-10-18(20)24(28)29-2/h5-7,9-11,15-17,19,21,23,25,27H,3-4,8,12-14H2,1-2H3/b9-5+/t15-,16+,17-,19+,21+,23-/m0/s1 |
| InChIKey | BTPZWKMKNMOYLO-RSJWERRTSA-N |
| XLogP | 3.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|