C14H19N3 — CID 117331093
1-[2-(4,5-dihydroimidazol-1-yl)phenyl]cyclopentan-1-amine (PubChem CID 117331093) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-[2-(4,5-dihydroimidazol-1-yl)phenyl]cyclopentan-1-amine.
| Compound Name | 1-[2-(4,5-dihydroimidazol-1-yl)phenyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 117331093 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-[2-(4,5-dihydroimidazol-1-yl)phenyl]cyclopentan-1-amine |
| SMILES | NC1(c2ccccc2N2C=NCC2)CCCC1 |
| InChI | InChI=1S/C14H19N3/c15-14(7-3-4-8-14)12-5-1-2-6-13(12)17-10-9-16-11-17/h1-2,5-6,11H,3-4,7-10,15H2 |
| InChIKey | ZFRCGYCLZHFQMI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |