C11H13ClFNO — CID 117331543
2-[1-(1-aminoethyl)cyclopropyl]-6-chloro-3-fluorophenol (PubChem CID 117331543) has the molecular formula C11H13ClFNO and a molecular weight of 229.68 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)cyclopropyl]-6-chloro-3-fluorophenol.
| Compound Name | 2-[1-(1-aminoethyl)cyclopropyl]-6-chloro-3-fluorophenol |
|---|---|
| PubChem CID | 117331543 |
| Molecular Formula | C11H13ClFNO |
| Molecular Weight | 229.68 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[1-(1-aminoethyl)cyclopropyl]-6-chloro-3-fluorophenol |
| SMILES | CC(N)C1(c2c(F)ccc(Cl)c2O)CC1 |
| InChI | InChI=1S/C11H13ClFNO/c1-6(14)11(4-5-11)9-8(13)3-2-7(12)10(9)15/h2-3,6,15H,4-5,14H2,1H3 |
| InChIKey | ZEQIEDABEPUXFD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |