About O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine
O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine (PubChem CID 117331835) has the molecular formula C9H12BrNO
and a molecular weight of 230.10 g/mol. Its IUPAC name is O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine |
| PubChem CID | 117331835 |
| Molecular Formula | C9H12BrNO |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine |
| SMILES | Cc1ccc(Br)c(CON)c1C |
| InChI | InChI=1S/C9H12BrNO/c1-6-3-4-9(10)8(5-12-11)7(6)2/h3-4H,5,11H2,1-2H3 |
| InChIKey | AEIKIYZKJWHLMJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine?
The IUPAC name of O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine (CID 117331835) is O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine.
What is the SMILES notation for O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine?
The canonical SMILES for O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine is Cc1ccc(Br)c(CON)c1C.
What is the InChIKey of O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine?
The InChIKey is AEIKIYZKJWHLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO/c1-6-3-4-9(10)8(5-12-11)7(6)2/h3-4H,5,11H2,1-2H3.
What are the key properties of O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine?
O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine has a molecular weight of 230.10 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(6-bromo-2,3-dimethylphenyl)methyl]hydroxylamine is sourced from PubChem (CID 117331835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).