About N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine
N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine (PubChem CID 11733265) has the molecular formula C18H28N2O6P2S
and a molecular weight of 462.45 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 11733265 |
| Molecular Formula | C18H28N2O6P2S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine |
| SMILES | CCOP(=O)(OCC)C(Nc1ncc(-c2ccccc2)s1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H28N2O6P2S/c1-5-23-27(21,24-6-2)18(28(22,25-7-3)26-8-4)20-17-19-14-16(29-17)15-12-10-9-11-13-15/h9-14,18H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | LCGHDOOSOQBHDW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine?
The IUPAC name of N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine (CID 11733265) is N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine is CCOP(=O)(OCC)C(Nc1ncc(-c2ccccc2)s1)P(=O)(OCC)OCC.
What is the InChIKey of N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine?
The InChIKey is LCGHDOOSOQBHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O6P2S/c1-5-23-27(21,24-6-2)18(28(22,25-7-3)26-8-4)20-17-19-14-16(29-17)15-12-10-9-11-13-15/h9-14,18H,5-8H2,1-4H3,(H,19,20).
What are the key properties of N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine?
N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine has a molecular weight of 462.45 g/mol, XLogP of 6.04, 13 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(diethoxyphosphoryl)methyl]-5-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 11733265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).