C28H36O4S — CID 11733356
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-5-(benzenesulfonyl)-4-methylpent-2-enoate (PubChem CID 11733356) has the molecular formula C28H36O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-5-(benzenesulfonyl)-4-methylpent-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-5-(benzenesulfonyl)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 11733356 |
| Molecular Formula | C28H36O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (E,4S)-5-(benzenesulfonyl)-4-methylpent-2-enoate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)/C=C/[C@H](C)CS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H36O4S/c1-21-15-17-25(28(3,4)23-11-7-5-8-12-23)26(19-21)32-27(29)18-16-22(2)20-33(30,31)24-13-9-6-10-14-24/h5-14,16,18,21-22,25-26H,15,17,19-20H2,1-4H3/b18-16+/t21-,22+,25-,26-/m1/s1 |
| InChIKey | LJOHZCSWCXKBFH-DXZWRHJDSA-N |
| XLogP | 5.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|