About carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide
carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide (PubChem CID 11733398) has the molecular formula C18H11Co2NO7
and a molecular weight of 471.15 g/mol. Its IUPAC name is carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide.
Molecular Properties
| Compound Name | carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide |
| PubChem CID | 11733398 |
| Molecular Formula | C18H11Co2NO7 |
| Molecular Weight | 471.15 g/mol |
| Exact Mass | 470.92 |
| IUPAC Name | carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide |
| SMILES | C=CCNC(=O)C#Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co] |
| InChI | InChI=1S/C12H11NO.6CO.2Co/c1-2-10-13-12(14)9-8-11-6-4-3-5-7-11;6*1-2;;/h2-7H,1,10H2,(H,13,14);;;;;;;; |
| InChIKey | YEZIZTAQQNRUME-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide?
The IUPAC name of carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide (CID 11733398) is carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide.
What is the SMILES notation for carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide?
The canonical SMILES for carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide is C=CCNC(=O)C#Cc1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Co].[Co].
What is the InChIKey of carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide?
The InChIKey is YEZIZTAQQNRUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.6CO.2Co/c1-2-10-13-12(14)9-8-11-6-4-3-5-7-11;6*1-2;;/h2-7H,1,10H2,(H,13,14);;;;;;;;.
What are the key properties of carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide?
carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide has a molecular weight of 471.15 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;cobalt;3-phenyl-N-prop-2-enylprop-2-ynamide is sourced from PubChem (CID 11733398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).