C23H32N2O9 — CID 11733538
[(3S,6S,7R,8R)-8-butyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 11733538) has the molecular formula C23H32N2O9 and a molecular weight of 480.51 g/mol. Its IUPAC name is [(3S,6S,7R,8R)-8-butyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(3S,6S,7R,8R)-8-butyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 11733538 |
| Molecular Formula | C23H32N2O9 |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | [(3S,6S,7R,8R)-8-butyl-3-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CCCC[C@H]1C(=O)OC[C@H](NC(=O)c2nccc(OC)c2O)C(=O)O[C@@H](C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C23H32N2O9/c1-6-7-8-14-19(34-21(28)12(2)3)13(4)33-23(30)15(11-32-22(14)29)25-20(27)17-18(26)16(31-5)9-10-24-17/h9-10,12-15,19,26H,6-8,11H2,1-5H3,(H,25,27)/t13-,14+,15-,19-/m0/s1 |
| InChIKey | YHCKIECGODHDIP-YGTYGHESSA-N |
| XLogP | 1.76 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|