C11H12N4O2 — CID 117336131
1-[3-(3-amino-1,2-oxazol-5-yl)phenyl]-1-methylurea (PubChem CID 117336131) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-[3-(3-amino-1,2-oxazol-5-yl)phenyl]-1-methylurea.
| Compound Name | 1-[3-(3-amino-1,2-oxazol-5-yl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 117336131 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1-[3-(3-amino-1,2-oxazol-5-yl)phenyl]-1-methylurea |
| SMILES | CN(C(N)=O)c1cccc(-c2cc(N)no2)c1 |
| InChI | InChI=1S/C11H12N4O2/c1-15(11(13)16)8-4-2-3-7(5-8)9-6-10(12)14-17-9/h2-6H,1H3,(H2,12,14)(H2,13,16) |
| InChIKey | DNXAWXRCMGQZCX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |