C13H16N2O2 — CID 117336573
O-[2-(1,3,4,5-tetrahydropyrano[4,3-b]indol-8-yl)ethyl]hydroxylamine (PubChem CID 117336573) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is O-[2-(1,3,4,5-tetrahydropyrano[4,3-b]indol-8-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(1,3,4,5-tetrahydropyrano[4,3-b]indol-8-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117336573 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | O-[2-(1,3,4,5-tetrahydropyrano[4,3-b]indol-8-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1ccc2[nH]c3c(c2c1)COCC3 |
| InChI | InChI=1S/C13H16N2O2/c14-17-6-3-9-1-2-12-10(7-9)11-8-16-5-4-13(11)15-12/h1-2,7,15H,3-6,8,14H2 |
| InChIKey | OXQAIUGNPQAQIP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|