About 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid
4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid (PubChem CID 117336753) has the molecular formula C15H20O2
and a molecular weight of 232.32 g/mol. Its IUPAC name is 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid.
Analyze 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid?
The IUPAC name of 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid (CID 117336753) is 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid.
What is the SMILES notation for 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid?
The canonical SMILES for 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid is Cc1ccc(CCCC(=O)O)c2c1CCCC2.
What is the InChIKey of 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid?
The InChIKey is YYPJIXACLSDKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-11-9-10-12(5-4-8-15(16)17)14-7-3-2-6-13(11)14/h9-10H,2-8H2,1H3,(H,16,17).
What are the key properties of 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid?
4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid has a molecular weight of 232.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-5,6,7,8-tetrahydronaphthalen-1-yl)butanoic acid is sourced from PubChem (CID 117336753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).