C24H33BrO4S — CID 11733766
(4S,5S)-7-(benzenesulfonylmethyl)-4-[(Z)-3-bromo-2-methylprop-1-enyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene (PubChem CID 11733766) has the molecular formula C24H33BrO4S and a molecular weight of 497.50 g/mol. Its IUPAC name is (4S,5S)-7-(benzenesulfonylmethyl)-4-[(Z)-3-bromo-2-methylprop-1-enyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene.
| Compound Name | (4S,5S)-7-(benzenesulfonylmethyl)-4-[(Z)-3-bromo-2-methylprop-1-enyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 11733766 |
| Molecular Formula | C24H33BrO4S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | (4S,5S)-7-(benzenesulfonylmethyl)-4-[(Z)-3-bromo-2-methylprop-1-enyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC1=C(CS(=O)(=O)c2ccccc2)C(C)(C)[C@]2(CC1)OC(C)(C)O[C@H]2/C=C(/C)CBr |
| InChI | InChI=1S/C24H33BrO4S/c1-17(15-25)14-21-24(29-23(5,6)28-21)13-12-18(2)20(22(24,3)4)16-30(26,27)19-10-8-7-9-11-19/h7-11,14,21H,12-13,15-16H2,1-6H3/b17-14-/t21-,24+/m0/s1 |
| InChIKey | ZZIFDFYFZNXABM-DLDUXKIOSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|