About 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate
4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate (PubChem CID 11733795) has the molecular formula C32H37NO4
and a molecular weight of 499.65 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate |
| PubChem CID | 11733795 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate |
| SMILES | C=CC[C@H](C(=O)OC(C)(C)C)[C@@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H37NO4/c1-5-15-28(30(34)37-32(2,3)4)29(31(35)36-24-27-20-13-8-14-21-27)33(22-25-16-9-6-10-17-25)23-26-18-11-7-12-19-26/h5-14,16-21,28-29H,1,15,22-24H2,2-4H3/t28-,29-/m0/s1 |
| InChIKey | AFKWNDHHZSTXFF-VMPREFPWSA-N |
| XLogP | 6.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate?
The IUPAC name of 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate (CID 11733795) is 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate?
The canonical SMILES for 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate is C=CC[C@H](C(=O)OC(C)(C)C)[C@@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate?
The InChIKey is AFKWNDHHZSTXFF-VMPREFPWSA-N. The full InChI is InChI=1S/C32H37NO4/c1-5-15-28(30(34)37-32(2,3)4)29(31(35)36-24-27-20-13-8-14-21-27)33(22-25-16-9-6-10-17-25)23-26-18-11-7-12-19-26/h5-14,16-21,28-29H,1,15,22-24H2,2-4H3/t28-,29-/m0/s1.
What are the key properties of 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate?
4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate has a molecular weight of 499.65 g/mol, XLogP of 6.33, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-tert-butyl (2S,3S)-3-(dibenzylamino)-2-prop-2-enylbutanedioate is sourced from PubChem (CID 11733795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).