C25H25FN6OS — CID 1173389
N-[4-(dimethylamino)phenyl]-2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 1173389) has the molecular formula C25H25FN6OS and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1173389 |
| Molecular Formula | C25H25FN6OS |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-[[5-[(4-fluoroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)CSc2nnc(CNc3ccc(F)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25FN6OS/c1-31(2)21-14-12-20(13-15-21)28-24(33)17-34-25-30-29-23(32(25)22-6-4-3-5-7-22)16-27-19-10-8-18(26)9-11-19/h3-15,27H,16-17H2,1-2H3,(H,28,33) |
| InChIKey | XSZOPBCTYVOSFK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|