About 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol
2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol (PubChem CID 117339277) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol.
Molecular Properties
| Compound Name | 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol |
| PubChem CID | 117339277 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol |
| SMILES | CC(C)(C)Cc1ccc(O)c(C2(N)CCC2)c1 |
| InChI | InChI=1S/C15H23NO/c1-14(2,3)10-11-5-6-13(17)12(9-11)15(16)7-4-8-15/h5-6,9,17H,4,7-8,10,16H2,1-3H3 |
| InChIKey | OCLRDPMRTBCSGD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol?
The IUPAC name of 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol (CID 117339277) is 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol.
What is the SMILES notation for 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol?
The canonical SMILES for 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol is CC(C)(C)Cc1ccc(O)c(C2(N)CCC2)c1.
What is the InChIKey of 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol?
The InChIKey is OCLRDPMRTBCSGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-14(2,3)10-11-5-6-13(17)12(9-11)15(16)7-4-8-15/h5-6,9,17H,4,7-8,10,16H2,1-3H3.
What are the key properties of 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol?
2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol has a molecular weight of 233.35 g/mol, XLogP of 3.32, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminocyclobutyl)-4-(2,2-dimethylpropyl)phenol is sourced from PubChem (CID 117339277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).