C15H23NO — CID 117339349
1-(4-aminobutyl)-4-methyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 117339349) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(4-aminobutyl)-4-methyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 1-(4-aminobutyl)-4-methyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 117339349 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(4-aminobutyl)-4-methyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Cc1cc(O)c(CCCCN)c2c1CCCC2 |
| InChI | InChI=1S/C15H23NO/c1-11-10-15(17)14(8-4-5-9-16)13-7-3-2-6-12(11)13/h10,17H,2-9,16H2,1H3 |
| InChIKey | NORUYHWRINNXGI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|