C27H46O7Si — CID 11733956
[(1S,3R,8S,10R,12S,13R)-12-[[(4aR,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]methyl]-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11733956) has the molecular formula C27H46O7Si and a molecular weight of 510.74 g/mol. Its IUPAC name is [(1S,3R,8S,10R,12S,13R)-12-[[(4aR,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]methyl]-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3R,8S,10R,12S,13R)-12-[[(4aR,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]methyl]-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11733956 |
| Molecular Formula | C27H46O7Si |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [(1S,3R,8S,10R,12S,13R)-12-[[(4aR,8aS)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2-yl]methyl]-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-13-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OC[C@H]2O[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC4=CC[C@H]5OCCC[C@@H]5O4)O[C@@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C27H46O7Si/c1-26(2,3)35(6,7)34-24-15-22-21(14-23-25(32-22)16-29-27(4,5)33-23)31-20(24)13-17-10-11-18-19(30-17)9-8-12-28-18/h10,18-25H,8-9,11-16H2,1-7H3/t18-,19+,20+,21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | ZDIFBEQLEZHWMP-KEZXODKSSA-N |
| XLogP | 5.09 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|