C28H27Cl2NO4 — CID 11733969
phenyl 2-[(3R,5S)-7-chloro-5-(2-chlorophenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetate (PubChem CID 11733969) has the molecular formula C28H27Cl2NO4 and a molecular weight of 512.43 g/mol. Its IUPAC name is phenyl 2-[(3R,5S)-7-chloro-5-(2-chlorophenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetate.
| Compound Name | phenyl 2-[(3R,5S)-7-chloro-5-(2-chlorophenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetate |
|---|---|
| PubChem CID | 11733969 |
| Molecular Formula | C28H27Cl2NO4 |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | phenyl 2-[(3R,5S)-7-chloro-5-(2-chlorophenyl)-1-(2,2-dimethylpropyl)-2-oxo-5H-4,1-benzoxazepin-3-yl]acetate |
| SMILES | CC(C)(C)CN1C(=O)[C@@H](CC(=O)Oc2ccccc2)O[C@H](c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H27Cl2NO4/c1-28(2,3)17-31-23-14-13-18(29)15-21(23)26(20-11-7-8-12-22(20)30)35-24(27(31)33)16-25(32)34-19-9-5-4-6-10-19/h4-15,24,26H,16-17H2,1-3H3/t24-,26-/m1/s1 |
| InChIKey | GPBCFQLQFCYLFZ-AOYPEHQESA-N |
| XLogP | 6.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|