About 3-bromo-2,5-difluoro-6-hydroxybenzonitrile
3-bromo-2,5-difluoro-6-hydroxybenzonitrile (PubChem CID 117339712) has the molecular formula C7H2BrF2NO
and a molecular weight of 234.00 g/mol. Its IUPAC name is 3-bromo-2,5-difluoro-6-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 3-bromo-2,5-difluoro-6-hydroxybenzonitrile |
| PubChem CID | 117339712 |
| Molecular Formula | C7H2BrF2NO |
| Molecular Weight | 234.00 g/mol |
| Exact Mass | 232.93 |
| IUPAC Name | 3-bromo-2,5-difluoro-6-hydroxybenzonitrile |
| SMILES | N#Cc1c(O)c(F)cc(Br)c1F |
| InChI | InChI=1S/C7H2BrF2NO/c8-4-1-5(9)7(12)3(2-11)6(4)10/h1,12H |
| InChIKey | DOLAZQUXAKSQRB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,5-difluoro-6-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,5-difluoro-6-hydroxybenzonitrile?
The IUPAC name of 3-bromo-2,5-difluoro-6-hydroxybenzonitrile (CID 117339712) is 3-bromo-2,5-difluoro-6-hydroxybenzonitrile.
What is the SMILES notation for 3-bromo-2,5-difluoro-6-hydroxybenzonitrile?
The canonical SMILES for 3-bromo-2,5-difluoro-6-hydroxybenzonitrile is N#Cc1c(O)c(F)cc(Br)c1F.
What is the InChIKey of 3-bromo-2,5-difluoro-6-hydroxybenzonitrile?
The InChIKey is DOLAZQUXAKSQRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrF2NO/c8-4-1-5(9)7(12)3(2-11)6(4)10/h1,12H.
What are the key properties of 3-bromo-2,5-difluoro-6-hydroxybenzonitrile?
3-bromo-2,5-difluoro-6-hydroxybenzonitrile has a molecular weight of 234.00 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,5-difluoro-6-hydroxybenzonitrile is sourced from PubChem (CID 117339712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).