C22H28Cl2N4O6 — CID 11734005
2,7-bis(chloromethyl)-5,10-dimethoxy-3,8-bis(3-methoxypropyl)pyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 11734005) has the molecular formula C22H28Cl2N4O6 and a molecular weight of 515.39 g/mol. Its IUPAC name is 2,7-bis(chloromethyl)-5,10-dimethoxy-3,8-bis(3-methoxypropyl)pyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2,7-bis(chloromethyl)-5,10-dimethoxy-3,8-bis(3-methoxypropyl)pyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 11734005 |
| Molecular Formula | C22H28Cl2N4O6 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2,7-bis(chloromethyl)-5,10-dimethoxy-3,8-bis(3-methoxypropyl)pyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | COCCCn1c(CCl)nc2c(OC)c3c(=O)n(CCCOC)c(CCl)nc3c(OC)c2c1=O |
| InChI | InChI=1S/C22H28Cl2N4O6/c1-31-9-5-7-27-13(11-23)25-17-15(21(27)29)19(33-3)18-16(20(17)34-4)22(30)28(8-6-10-32-2)14(12-24)26-18/h5-12H2,1-4H3 |
| InChIKey | NAKDUXFQARDXIZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|