C24H29N5O6S — CID 11734007
tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-4-(6-nitro-1,3-benzothiazol-2-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 11734007) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-4-(6-nitro-1,3-benzothiazol-2-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-4-(6-nitro-1,3-benzothiazol-2-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11734007 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | tert-butyl (2S)-2-[(3aS,6S,6aR)-6-methyl-4-(6-nitro-1,3-benzothiazol-2-yl)-5-oxo-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C(=O)N(c2nc3ccc([N+](=O)[O-])cc3s2)[C@H]2CCN(C(=O)[C@@H]3CCCN3C(=O)OC(C)(C)C)[C@H]12 |
| InChI | InChI=1S/C24H29N5O6S/c1-13-19-16(28(20(13)30)22-25-15-8-7-14(29(33)34)12-18(15)36-22)9-11-27(19)21(31)17-6-5-10-26(17)23(32)35-24(2,3)4/h7-8,12-13,16-17,19H,5-6,9-11H2,1-4H3/t13-,16-,17-,19+/m0/s1 |
| InChIKey | NYUPSAVALYKRBI-LZLXCTOHSA-N |
| XLogP | 3.56 |
| TPSA | 126.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|