C32H38FN3O2 — CID 11734011
3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-(4-fluorophenyl)-N-propylbenzamide (PubChem CID 11734011) has the molecular formula C32H38FN3O2 and a molecular weight of 515.67 g/mol. Its IUPAC name is 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-(4-fluorophenyl)-N-propylbenzamide.
| Compound Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-(4-fluorophenyl)-N-propylbenzamide |
|---|---|
| PubChem CID | 11734011 |
| Molecular Formula | C32H38FN3O2 |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-(3-hydroxyphenyl)methyl]-N-(4-fluorophenyl)-N-propylbenzamide |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2cccc(O)c2)c2cccc(C(=O)N(CCC)c3ccc(F)cc3)c2)C[C@H]1C |
| InChI | InChI=1S/C32H38FN3O2/c1-5-17-34-21-24(4)36(22-23(34)3)31(26-10-8-12-30(37)20-26)25-9-7-11-27(19-25)32(38)35(18-6-2)29-15-13-28(33)14-16-29/h5,7-16,19-20,23-24,31,37H,1,6,17-18,21-22H2,2-4H3/t23-,24+,31-/m1/s1 |
| InChIKey | BJPIPSKGIBDMDN-ULPIOCOXSA-N |
| XLogP | 6.26 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|