C12H14N2O3 — CID 117340342
3-(2,6-dimethoxy-3-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 117340342) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-(2,6-dimethoxy-3-methylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(2,6-dimethoxy-3-methylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117340342 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-(2,6-dimethoxy-3-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(C)c(OC)c1-c1cc(N)on1 |
| InChI | InChI=1S/C12H14N2O3/c1-7-4-5-9(15-2)11(12(7)16-3)8-6-10(13)17-14-8/h4-6H,13H2,1-3H3 |
| InChIKey | KUIYNTFRBPJDHV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |