C26H50O7Si2 — CID 11734161
3-[(1S,3R)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1,3-bis(triethylsilyloxy)propyl]-2H-furan-5-one (PubChem CID 11734161) has the molecular formula C26H50O7Si2 and a molecular weight of 530.85 g/mol. Its IUPAC name is 3-[(1S,3R)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1,3-bis(triethylsilyloxy)propyl]-2H-furan-5-one.
| Compound Name | 3-[(1S,3R)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1,3-bis(triethylsilyloxy)propyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 11734161 |
| Molecular Formula | C26H50O7Si2 |
| Molecular Weight | 530.85 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 3-[(1S,3R)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1,3-bis(triethylsilyloxy)propyl]-2H-furan-5-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@@H](O[Si](CC)(CC)CC)C1(CO)COC(C)(C)OC1)C1=CC(=O)OC1 |
| InChI | InChI=1S/C26H50O7Si2/c1-9-34(10-2,11-3)32-22(21-15-24(28)29-17-21)16-23(33-35(12-4,13-5)14-6)26(18-27)19-30-25(7,8)31-20-26/h15,22-23,27H,9-14,16-20H2,1-8H3/t22-,23+/m0/s1 |
| InChIKey | TZFNGHJRWYEMQF-XZOQPEGZSA-N |
| XLogP | 5.40 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|