C32H40N2O5 — CID 11734173
N-butyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide (PubChem CID 11734173) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is N-butyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide.
| Compound Name | N-butyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 11734173 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | N-butyl-2-[1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-phenylacetamide |
| SMILES | CCCCNC(=O)C(c1ccccc1)N1CCc2cc(OC)c(OC)cc2C1Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H40N2O5/c1-6-7-16-33-32(35)31(23-11-9-8-10-12-23)34-17-15-24-20-29(38-4)30(39-5)21-25(24)26(34)18-22-13-14-27(36-2)28(19-22)37-3/h8-14,19-21,26,31H,6-7,15-18H2,1-5H3,(H,33,35) |
| InChIKey | IHCFTGHARRXKNR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|