C32H56O4Si — CID 11734178
(1R,3aS,5E,6aS)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 11734178) has the molecular formula C32H56O4Si and a molecular weight of 532.88 g/mol. Its IUPAC name is (1R,3aS,5E,6aS)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (1R,3aS,5E,6aS)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 11734178 |
| Molecular Formula | C32H56O4Si |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | (1R,3aS,5E,6aS)-1-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-[5-(oxan-2-yloxy)pentylidene]-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | CCCCCC(/C=C/[C@H]1C(=O)C[C@@H]2C/C(=C\CCCCOC3CCCCO3)C[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56O4Si/c1-7-8-10-16-27(36-37(5,6)32(2,3)4)18-19-28-29-23-25(22-26(29)24-30(28)33)15-11-9-13-20-34-31-17-12-14-21-35-31/h15,18-19,26-29,31H,7-14,16-17,20-24H2,1-6H3/b19-18+,25-15+/t26-,27?,28+,29-,31?/m0/s1 |
| InChIKey | DACITOLIISKBIB-JWBHKJFWSA-N |
| XLogP | 8.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|