C29H46O7Si — CID 11734197
(1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-ene-3,7-dione (PubChem CID 11734197) has the molecular formula C29H46O7Si and a molecular weight of 534.77 g/mol. Its IUPAC name is (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-ene-3,7-dione.
| Compound Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-ene-3,7-dione |
|---|---|
| PubChem CID | 11734197 |
| Molecular Formula | C29H46O7Si |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | (1S,5S,6R,11R,12R,16R,19S)-11,14,14,18,21,21-hexamethyl-19-triethylsilyloxy-2,4,13,15-tetraoxapentacyclo[15.3.1.01,5.06,11.012,16]henicos-17-ene-3,7-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2[C@@H]2C(=O)CCC[C@@]2(C)[C@H]2OC(C)(C)O[C@@H]2C(=C1C)C3(C)C |
| InChI | InChI=1S/C29H46O7Si/c1-10-37(11-2,12-3)36-19-16-29-23(32-25(31)35-29)21-18(30)14-13-15-28(21,9)24-22(33-27(7,8)34-24)20(17(19)4)26(29,5)6/h19,21-24H,10-16H2,1-9H3/t19-,21-,22+,23-,24-,28+,29+/m0/s1 |
| InChIKey | ANPKICXEFWISDY-ZAEXJDIXSA-N |
| XLogP | 6.31 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|