C30H52O6Si — CID 11734214
ethyl (2Z)-2-[(5S)-5-[(1R)-2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-triethylsilyloxyethyl]-5-methylfuran-2-ylidene]acetate (PubChem CID 11734214) has the molecular formula C30H52O6Si and a molecular weight of 536.83 g/mol. Its IUPAC name is ethyl (2Z)-2-[(5S)-5-[(1R)-2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-triethylsilyloxyethyl]-5-methylfuran-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(5S)-5-[(1R)-2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-triethylsilyloxyethyl]-5-methylfuran-2-ylidene]acetate |
|---|---|
| PubChem CID | 11734214 |
| Molecular Formula | C30H52O6Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | ethyl (2Z)-2-[(5S)-5-[(1R)-2-[(1R,5R,6R)-6-(dimethoxymethyl)-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-1-triethylsilyloxyethyl]-5-methylfuran-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C[C@@](C)([C@@H](C[C@H]2C(C)=CC[C@H](C(C)C)[C@H]2C(OC)OC)O[Si](CC)(CC)CC)O1 |
| InChI | InChI=1S/C30H52O6Si/c1-11-34-27(31)19-23-17-18-30(8,35-23)26(36-37(12-2,13-3)14-4)20-25-22(7)15-16-24(21(5)6)28(25)29(32-9)33-10/h15,17-19,21,24-26,28-29H,11-14,16,20H2,1-10H3/b23-19-/t24-,25+,26-,28-,30+/m1/s1 |
| InChIKey | JPCBNPGRAOQBED-OIYZJLLCSA-N |
| XLogP | 7.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|