About 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one
6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one (PubChem CID 117342293) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| PubChem CID | 117342293 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(CCCO)cc2NC1=O |
| InChI | InChI=1S/C13H17NO3/c1-13(2)12(16)14-10-8-9(4-3-7-15)5-6-11(10)17-13/h5-6,8,15H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | ARNGYZPJZQUXSO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CID 117342293) is 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one is CC1(C)Oc2ccc(CCCO)cc2NC1=O.
What is the InChIKey of 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
The InChIKey is ARNGYZPJZQUXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-13(2)12(16)14-10-8-9(4-3-7-15)5-6-11(10)17-13/h5-6,8,15H,3-4,7H2,1-2H3,(H,14,16).
What are the key properties of 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one?
6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one has a molecular weight of 235.28 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-hydroxypropyl)-2,2-dimethyl-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 117342293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).