C12H13NO2S — CID 117342575
4-(2-methylpyrrolidin-2-yl)-1,3-benzoxathiol-2-one (PubChem CID 117342575) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-2-yl)-1,3-benzoxathiol-2-one.
| Compound Name | 4-(2-methylpyrrolidin-2-yl)-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117342575 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 4-(2-methylpyrrolidin-2-yl)-1,3-benzoxathiol-2-one |
| SMILES | CC1(c2cccc3oc(=O)sc23)CCCN1 |
| InChI | InChI=1S/C12H13NO2S/c1-12(6-3-7-13-12)8-4-2-5-9-10(8)16-11(14)15-9/h2,4-5,13H,3,6-7H2,1H3 |
| InChIKey | WJMBHKMAOVUZEN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |