C30H54O6Si2 — CID 11734467
methyl (2E,5S,6R,7R,8R,9R,10Z)-11-(acetyloxymethyl)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-13-trimethylsilyltrideca-2,10-dien-12-ynoate (PubChem CID 11734467) has the molecular formula C30H54O6Si2 and a molecular weight of 566.93 g/mol. Its IUPAC name is methyl (2E,5S,6R,7R,8R,9R,10Z)-11-(acetyloxymethyl)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-13-trimethylsilyltrideca-2,10-dien-12-ynoate.
| Compound Name | methyl (2E,5S,6R,7R,8R,9R,10Z)-11-(acetyloxymethyl)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-13-trimethylsilyltrideca-2,10-dien-12-ynoate |
|---|---|
| PubChem CID | 11734467 |
| Molecular Formula | C30H54O6Si2 |
| Molecular Weight | 566.93 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | methyl (2E,5S,6R,7R,8R,9R,10Z)-11-(acetyloxymethyl)-6-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-3,5,7,9-tetramethyl-13-trimethylsilyltrideca-2,10-dien-12-ynoate |
| SMILES | COC(=O)/C=C(\C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)[C@H](C)/C=C(/C#C[Si](C)(C)C)COC(C)=O |
| InChI | InChI=1S/C30H54O6Si2/c1-21(18-27(32)34-9)17-23(3)29(36-38(13,14)30(6,7)8)24(4)28(33)22(2)19-26(20-35-25(5)31)15-16-37(10,11)12/h18-19,22-24,28-29,33H,17,20H2,1-14H3/b21-18+,26-19-/t22-,23+,24-,28-,29-/m1/s1 |
| InChIKey | MQJPNZUKACBIHK-JVVWENPSSA-N |
| XLogP | 6.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.93 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|