C13H19NO3 — CID 117347185
O-[2-(2-cyclobutyloxy-3-methoxyphenyl)ethyl]hydroxylamine (PubChem CID 117347185) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is O-[2-(2-cyclobutyloxy-3-methoxyphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(2-cyclobutyloxy-3-methoxyphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117347185 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | O-[2-(2-cyclobutyloxy-3-methoxyphenyl)ethyl]hydroxylamine |
| SMILES | COc1cccc(CCON)c1OC1CCC1 |
| InChI | InChI=1S/C13H19NO3/c1-15-12-7-2-4-10(8-9-16-14)13(12)17-11-5-3-6-11/h2,4,7,11H,3,5-6,8-9,14H2,1H3 |
| InChIKey | POBGPRJZBXYOHK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|