C15H15N3 — CID 117347244
2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)acetonitrile (PubChem CID 117347244) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)acetonitrile.
| Compound Name | 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)acetonitrile |
|---|---|
| PubChem CID | 117347244 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)acetonitrile |
| SMILES | N#CCc1cccc2c3c([nH]c12)N1CCC3CC1 |
| InChI | InChI=1S/C15H15N3/c16-7-4-11-2-1-3-12-13-10-5-8-18(9-6-10)15(13)17-14(11)12/h1-3,10,17H,4-6,8-9H2 |
| InChIKey | FPXBWXNUDNMHNF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |