C14H23NO2 — CID 117347740
N-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]hydroxylamine (PubChem CID 117347740) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]hydroxylamine.
| Compound Name | N-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117347740 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]hydroxylamine |
| SMILES | COc1c(C(C)C)cc(CNO)cc1C(C)C |
| InChI | InChI=1S/C14H23NO2/c1-9(2)12-6-11(8-15-16)7-13(10(3)4)14(12)17-5/h6-7,9-10,15-16H,8H2,1-5H3 |
| InChIKey | XSJWKDXRJLGATO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|