C28H34N4O12 — CID 11734780
[(2R,3R,4R,5S,6E)-6-[acetyl-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinylidene]-2,3,4,5-tetraacetyloxyhexyl] acetate (PubChem CID 11734780) has the molecular formula C28H34N4O12 and a molecular weight of 618.60 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6E)-6-[acetyl-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinylidene]-2,3,4,5-tetraacetyloxyhexyl] acetate.
| Compound Name | [(2R,3R,4R,5S,6E)-6-[acetyl-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinylidene]-2,3,4,5-tetraacetyloxyhexyl] acetate |
|---|---|
| PubChem CID | 11734780 |
| Molecular Formula | C28H34N4O12 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | [(2R,3R,4R,5S,6E)-6-[acetyl-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinylidene]-2,3,4,5-tetraacetyloxyhexyl] acetate |
| SMILES | CCn1c(N(/N=C/[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)C(C)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H34N4O12/c1-8-31-27(39)21-11-9-10-12-22(21)30-28(31)32(15(2)33)29-13-23(41-17(4)35)25(43-19(6)37)26(44-20(7)38)24(42-18(5)36)14-40-16(3)34/h9-13,23-26H,8,14H2,1-7H3/b29-13+/t23-,24+,25+,26+/m0/s1 |
| InChIKey | VYPHHXJTTFRBLY-OUXORPRUSA-N |
| XLogP | 1.04 |
| TPSA | 199.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|