C13H16ClNO — CID 117348278
4-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)piperidine (PubChem CID 117348278) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 4-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)piperidine.
| Compound Name | 4-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)piperidine |
|---|---|
| PubChem CID | 117348278 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(5-chloro-2,3-dihydro-1-benzofuran-4-yl)piperidine |
| SMILES | Clc1ccc2c(c1C1CCNCC1)CCO2 |
| InChI | InChI=1S/C13H16ClNO/c14-11-1-2-12-10(5-8-16-12)13(11)9-3-6-15-7-4-9/h1-2,9,15H,3-8H2 |
| InChIKey | BCDLUDASVGTBQH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |