C39H58O3Si2 — CID 11734861
(3R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxyheptadec-1-en-4,6-diyn-9-ol (PubChem CID 11734861) has the molecular formula C39H58O3Si2 and a molecular weight of 631.06 g/mol. Its IUPAC name is (3R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxyheptadec-1-en-4,6-diyn-9-ol.
| Compound Name | (3R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxyheptadec-1-en-4,6-diyn-9-ol |
|---|---|
| PubChem CID | 11734861 |
| Molecular Formula | C39H58O3Si2 |
| Molecular Weight | 631.06 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | (3R,9R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxyheptadec-1-en-4,6-diyn-9-ol |
| SMILES | C=C[C@H](C#CC#CC[C@@H](O)[C@@H](CCCCCCC)O[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H58O3Si2/c1-11-13-14-15-25-32-37(42-43(9,10)38(3,4)5)36(40)31-24-16-19-26-33(12-2)41-44(39(6,7)8,34-27-20-17-21-28-34)35-29-22-18-23-30-35/h12,17-18,20-23,27-30,33,36-37,40H,2,11,13-15,25,31-32H2,1,3-10H3/t33-,36-,37-/m1/s1 |
| InChIKey | GPKVFLLZEBORRC-KUAYXKFLSA-N |
| XLogP | 8.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.06 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|